2,3-Dihydro-4-furoic acid - Names and Identifiers
Name | 4,5-dihydrofuran-3-carboxylic acid
|
Synonyms | 2,3-Dihydro-4-furoic acid 4,5-Dihydrofuran-3-carbox... 4,5-Dihydro-3-furancarboxylicacid 4,5-dihydrofuran-3-carboxylic acid 4,5-Dihydrofuran-3-carboxylic acid 4,5-DIHYDRO-FURAN-3-CARBOXYLIC ACID 3-Furancarboxylic acid, 4,5-dihydro-
|
CAS | 98021-62-6
|
InChI | InChI=1/C5H6O3/c6-5(7)4-1-2-8-3-4/h3H,1-2H2,(H,6,7) |
2,3-Dihydro-4-furoic acid - Physico-chemical Properties
Molecular Formula | C5H6O3
|
Molar Mass | 114.1 |
Density | 1.369g/cm3 |
Boling Point | 224.5°C at 760 mmHg |
Flash Point | 100.7°C |
Vapor Presure | 0.0334mmHg at 25°C |
Storage Condition | -20℃ |
Refractive Index | 1.53 |
2,3-Dihydro-4-furoic acid - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36 - Irritating to the eyes
|
Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
|
2,3-Dihydro-4-furoic acid - Introduction
4. Acid is an organic compound with the chemical formula C6H8O3. Its nature is as follows:
1. Appearance and physical properties: 4. acid is a colorless to light yellow solid with a special smell.
2. Solubility: It can be dissolved in water and polar organic solvents, such as alcohols and ethers.
3. Stability: Under dry conditions, it is relatively stable, but it is easy to decompose in a humid environment.
4. The uses and applications of acid are as follows:
1. Chemical synthesis: It can be used as a starting material or intermediate for organic synthesis and used to prepare other compounds, such as drugs, pesticides and dyes.
2. medical field: 4, acid can be used to synthesize some drugs, such as antiviral drugs and anti-tuberculosis drugs.
3. Chemical research: It can be used in organic synthesis, catalytic reactions and metal complexes research.
there are usually two methods for preparing 4 acid:
br>1. Condensation: Condensation propylene oxide with methanol, and then undergo an acid-catalyzed reaction to obtain 4 acid.
2. Hydrolysis of epoxy acetone: add water to epoxy acetone to react, and decompose by acid catalysis to obtain 4.
Regarding safety information, 4, acid has low toxicity under normal use conditions, but the following matters still need to be noted:
1. Avoid direct contact: When using, avoid direct contact with skin, eyes and respiratory tract. In case of accidental contact, wash the affected area immediately with plenty of water and seek medical help.
2. Storage Note: It should be stored in a sealed container, away from fire and oxidant.
3. waste disposal: waste disposal, should be in accordance with the local environmental regulations for the correct disposal, not random dumping.
When using and handling, it is recommended to follow relevant safety operating procedures to ensure personal safety and environmental protection.
Last Update:2024-04-09 20:02:46